C39H16BF12N6- — CID 139137019
tris(4,5,6,7-tetrafluoro-3-phenylindazol-1-yl)boranuide (PubChem CID 139137019) has the molecular formula C39H16BF12N6- and a molecular weight of 807.39 g/mol. Its IUPAC name is tris(4,5,6,7-tetrafluoro-3-phenylindazol-1-yl)boranuide.
| Compound Name | tris(4,5,6,7-tetrafluoro-3-phenylindazol-1-yl)boranuide |
|---|---|
| PubChem CID | 139137019 |
| Molecular Formula | C39H16BF12N6- |
| Molecular Weight | 807.39 g/mol |
| Exact Mass | 807.13 |
| IUPAC Name | tris(4,5,6,7-tetrafluoro-3-phenylindazol-1-yl)boranuide |
| SMILES | Fc1c(F)c(F)c2c(c(-c3ccccc3)nn2[BH-](n2nc(-c3ccccc3)c3c(F)c(F)c(F)c(F)c32)n2nc(-c3ccccc3)c3c(F)c(F)c(F)c(F)c32)c1F |
| InChI | InChI=1S/C39H16BF12N6/c41-22-19-34(16-10-4-1-5-11-16)53-56(37(19)31(50)28(47)25(22)44)40(57-38-20(23(42)26(45)29(48)32(38)51)35(54-57)17-12-6-2-7-13-17)58-39-21(24(43)27(46)30(49)33(39)52)36(55-58)18-14-8-3-9-15-18/h1-15,40H/q-1 |
| InChIKey | BXSNMLWCLCALKP-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.39 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|