C45H28BF12N6Tl — CID 139137020
thallium(1+);tris[3-(3,5-dimethylphenyl)-4,5,6,7-tetrafluoroindazol-1-yl]boranuide (PubChem CID 139137020) has the molecular formula C45H28BF12N6Tl and a molecular weight of 1095.93 g/mol. Its IUPAC name is thallium(1+);tris[3-(3,5-dimethylphenyl)-4,5,6,7-tetrafluoroindazol-1-yl]boranuide.
| Compound Name | thallium(1+);tris[3-(3,5-dimethylphenyl)-4,5,6,7-tetrafluoroindazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139137020 |
| Molecular Formula | C45H28BF12N6Tl |
| Molecular Weight | 1095.93 g/mol |
| Exact Mass | 1096.20 |
| IUPAC Name | thallium(1+);tris[3-(3,5-dimethylphenyl)-4,5,6,7-tetrafluoroindazol-1-yl]boranuide |
| SMILES | Cc1cc(C)cc(-c2nn([BH-](n3nc(-c4cc(C)cc(C)c4)c4c(F)c(F)c(F)c(F)c43)n3nc(-c4cc(C)cc(C)c4)c4c(F)c(F)c(F)c(F)c43)c3c(F)c(F)c(F)c(F)c23)c1.[Tl+] |
| InChI | InChI=1S/C45H28BF12N6.Tl/c1-16-7-17(2)11-22(10-16)40-25-28(47)31(50)34(53)37(56)43(25)62(59-40)46(63-44-26(29(48)32(51)35(54)38(44)57)41(60-63)23-12-18(3)8-19(4)13-23)64-45-27(30(49)33(52)36(55)39(45)58)42(61-64)24-14-20(5)9-21(6)15-24;/h7-15,46H,1-6H3;/q-1;+1 |
| InChIKey | WZDWQKJGVYMQHW-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.93 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|