About 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile
4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile (PubChem CID 139137259) has the molecular formula C20H14N6
and a molecular weight of 338.37 g/mol. Its IUPAC name is 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile |
| PubChem CID | 139137259 |
| Molecular Formula | C20H14N6 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2cc(-n3cccn3)nc(-n3cccn3)c2)cc1 |
| InChI | InChI=1S/C20H14N6/c21-15-17-6-3-16(4-7-17)5-8-18-13-19(25-11-1-9-22-25)24-20(14-18)26-12-2-10-23-26/h1-14H/b8-5+ |
| InChIKey | JLTZPAPPSVLJNE-VMPITWQZSA-N |
| XLogP | 3.50 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile?
The IUPAC name of 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile (CID 139137259) is 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile.
What is the SMILES notation for 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile?
The canonical SMILES for 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile is N#Cc1ccc(/C=C/c2cc(-n3cccn3)nc(-n3cccn3)c2)cc1.
What is the InChIKey of 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile?
The InChIKey is JLTZPAPPSVLJNE-VMPITWQZSA-N. The full InChI is InChI=1S/C20H14N6/c21-15-17-6-3-16(4-7-17)5-8-18-13-19(25-11-1-9-22-25)24-20(14-18)26-12-2-10-23-26/h1-14H/b8-5+.
What are the key properties of 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile?
4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile has a molecular weight of 338.37 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[2,6-di(pyrazol-1-yl)-4-pyridinyl]ethenyl]benzonitrile is sourced from PubChem (CID 139137259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).