C18H10Br2Cl4N2 — CID 139138135
1-N,4-N-bis(4-bromophenyl)-2,3,5,6-tetrachlorobenzene-1,4-diamine (PubChem CID 139138135) has the molecular formula C18H10Br2Cl4N2 and a molecular weight of 555.91 g/mol. Its IUPAC name is 1-N,4-N-bis(4-bromophenyl)-2,3,5,6-tetrachlorobenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(4-bromophenyl)-2,3,5,6-tetrachlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 139138135 |
| Molecular Formula | C18H10Br2Cl4N2 |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 551.80 |
| IUPAC Name | 1-N,4-N-bis(4-bromophenyl)-2,3,5,6-tetrachlorobenzene-1,4-diamine |
| SMILES | Clc1c(Cl)c(Nc2ccc(Br)cc2)c(Cl)c(Cl)c1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H10Br2Cl4N2/c19-9-1-5-11(6-2-9)25-17-13(21)15(23)18(16(24)14(17)22)26-12-7-3-10(20)4-8-12/h1-8,25-26H |
| InChIKey | UXCUGQKMGVWEFB-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|