C54H36B2N2O4 — CID 139138356
1-naphthalen-1-yl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene (PubChem CID 139138356) has the molecular formula C54H36B2N2O4 and a molecular weight of 798.52 g/mol. Its IUPAC name is 1-naphthalen-1-yl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene.
| Compound Name | 1-naphthalen-1-yl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 139138356 |
| Molecular Formula | C54H36B2N2O4 |
| Molecular Weight | 798.52 g/mol |
| Exact Mass | 798.29 |
| IUPAC Name | 1-naphthalen-1-yl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene |
| SMILES | c1ccc2c(c1)O[B-]1(c3cccc4ccccc34)Oc3ccccc3-c3cccc-2[n+]31.c1ccc2c(c1)O[B-]1(c3cccc4ccccc34)Oc3ccccc3-c3cccc-2[n+]31 |
| InChI | InChI=1S/2C27H18BNO2/c2*1-2-11-20-19(9-1)10-7-14-23(20)28-29-24(21-12-3-5-17-26(21)30-28)15-8-16-25(29)22-13-4-6-18-27(22)31-28/h2*1-18H |
| InChIKey | JSYFKMOFFFZLEY-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.52 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|