C25H19BCl3NO3 — CID 139138357
chloroform;1-(2-methoxyphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene (PubChem CID 139138357) has the molecular formula C25H19BCl3NO3 and a molecular weight of 498.60 g/mol. Its IUPAC name is chloroform;1-(2-methoxyphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene.
| Compound Name | chloroform;1-(2-methoxyphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 139138357 |
| Molecular Formula | C25H19BCl3NO3 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | chloroform;1-(2-methoxyphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene |
| SMILES | COc1ccccc1[B-]12Oc3ccccc3-c3cccc([n+]31)-c1ccccc1O2.ClC(Cl)Cl |
| InChI | InChI=1S/C24H18BNO3.CHCl3/c1-27-24-16-7-4-11-19(24)25-26-20(17-9-2-5-14-22(17)28-25)12-8-13-21(26)18-10-3-6-15-23(18)29-25;2-1(3)4/h2-16H,1H3;1H |
| InChIKey | SZGDAXMZARRNKN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|