C26H8F8N2O2S2Zn — CID 139139002
zinc bis(2-(4,5,6,7-tetrafluoro-1,3-benzothiazol-2-yl)phenolate) (PubChem CID 139139002) has the molecular formula C26H8F8N2O2S2Zn and a molecular weight of 661.87 g/mol. Its IUPAC name is zinc bis(2-(4,5,6,7-tetrafluoro-1,3-benzothiazol-2-yl)phenolate).
| Compound Name | zinc bis(2-(4,5,6,7-tetrafluoro-1,3-benzothiazol-2-yl)phenolate) |
|---|---|
| PubChem CID | 139139002 |
| Molecular Formula | C26H8F8N2O2S2Zn |
| Molecular Weight | 661.87 g/mol |
| Exact Mass | 659.92 |
| IUPAC Name | zinc bis(2-(4,5,6,7-tetrafluoro-1,3-benzothiazol-2-yl)phenolate) |
| SMILES | [O-]c1ccccc1-c1nc2c(F)c(F)c(F)c(F)c2s1.[O-]c1ccccc1-c1nc2c(F)c(F)c(F)c(F)c2s1.[Zn+2] |
| InChI | InChI=1S/2C13H5F4NOS.Zn/c2*14-7-8(15)10(17)12-11(9(7)16)18-13(20-12)5-3-1-2-4-6(5)19;/h2*1-4,19H;/q;;+2/p-2 |
| InChIKey | RTJKASSDXHCYRR-UHFFFAOYSA-L |
| XLogP | 7.18 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.87 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|