C18H13F3N4O3S — CID 139139527
1-(6-pyridin-2-yl-2-pyridinyl)pyrrolo[2,3-b]pyridin-7-ium;trifluoromethanesulfonate (PubChem CID 139139527) has the molecular formula C18H13F3N4O3S and a molecular weight of 422.39 g/mol. Its IUPAC name is 1-(6-pyridin-2-yl-2-pyridinyl)pyrrolo[2,3-b]pyridin-7-ium;trifluoromethanesulfonate.
| Compound Name | 1-(6-pyridin-2-yl-2-pyridinyl)pyrrolo[2,3-b]pyridin-7-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139139527 |
| Molecular Formula | C18H13F3N4O3S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 1-(6-pyridin-2-yl-2-pyridinyl)pyrrolo[2,3-b]pyridin-7-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-c2cccc(-n3ccc4ccc[nH+]c43)n2)nc1 |
| InChI | InChI=1S/C17H12N4.CHF3O3S/c1-2-10-18-14(6-1)15-7-3-8-16(20-15)21-12-9-13-5-4-11-19-17(13)21;2-1(3,4)8(5,6)7/h1-12H;(H,5,6,7) |
| InChIKey | HGSXSAADRNHWPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|