C48H58N6O14 — CID 139139654
dimethyl (2R,3S,6R)-2,6-bis(4-ethoxy-2-pyridinyl)-4-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-3,5-dicarboxylate (PubChem CID 139139654) has the molecular formula C48H58N6O14 and a molecular weight of 943.02 g/mol. Its IUPAC name is dimethyl (2R,3S,6R)-2,6-bis(4-ethoxy-2-pyridinyl)-4-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl (2R,3S,6R)-2,6-bis(4-ethoxy-2-pyridinyl)-4-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139139654 |
| Molecular Formula | C48H58N6O14 |
| Molecular Weight | 943.02 g/mol |
| Exact Mass | 942.40 |
| IUPAC Name | dimethyl (2R,3S,6R)-2,6-bis(4-ethoxy-2-pyridinyl)-4-hydroxy-1-methyl-3,6-dihydro-2H-pyridine-3,5-dicarboxylate |
| SMILES | CCOc1ccnc([C@H]2C(C(=O)OC)=C(O)[C@@H](C(=O)OC)[C@H](c3cc(OCC)ccn3)N2C)c1.CCOc1ccnc([C@H]2C(C(=O)OC)=C(O)[C@@H](C(=O)OC)[C@H](c3cc(OCC)ccn3)N2C)c1 |
| InChI | InChI=1S/2C24H29N3O7/c2*1-6-33-14-8-10-25-16(12-14)20-18(23(29)31-4)22(28)19(24(30)32-5)21(27(20)3)17-13-15(34-7-2)9-11-26-17/h2*8-13,18,20-21,28H,6-7H2,1-5H3/t2*18-,20-,21-/m00/s1 |
| InChIKey | RHILIOANLMKHNK-MXRKPEAQSA-N |
| XLogP | 5.55 |
| TPSA | 240.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.02 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|