C12H21N3 — CID 13914
2,4,6-tripropyl-1,3,5-triazine (PubChem CID 13914) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2,4,6-tripropyl-1,3,5-triazine.
| Compound Name | 2,4,6-tripropyl-1,3,5-triazine |
|---|---|
| PubChem CID | 13914 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2,4,6-tripropyl-1,3,5-triazine |
| SMILES | CCCc1nc(CCC)nc(CCC)n1 |
| InChI | InChI=1S/C12H21N3/c1-4-7-10-13-11(8-5-2)15-12(14-10)9-6-3/h4-9H2,1-3H3 |
| InChIKey | BBZCXXQQRGOUOW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |