C29H27N5O5 — CID 139140058
2-[[2-hydroxy-3-[(E)-(11H-indolo[3,2-c]quinolin-6-ylhydrazinylidene)methyl]-5-methylphenyl]methyl-(2-methoxy-2-oxoethyl)amino]acetic acid (PubChem CID 139140058) has the molecular formula C29H27N5O5 and a molecular weight of 525.57 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-[(E)-(11H-indolo[3,2-c]quinolin-6-ylhydrazinylidene)methyl]-5-methylphenyl]methyl-(2-methoxy-2-oxoethyl)amino]acetic acid.
| Compound Name | 2-[[2-hydroxy-3-[(E)-(11H-indolo[3,2-c]quinolin-6-ylhydrazinylidene)methyl]-5-methylphenyl]methyl-(2-methoxy-2-oxoethyl)amino]acetic acid |
|---|---|
| PubChem CID | 139140058 |
| Molecular Formula | C29H27N5O5 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 2-[[2-hydroxy-3-[(E)-(11H-indolo[3,2-c]quinolin-6-ylhydrazinylidene)methyl]-5-methylphenyl]methyl-(2-methoxy-2-oxoethyl)amino]acetic acid |
| SMILES | COC(=O)CN(CC(=O)O)Cc1cc(C)cc(/C=N/Nc2nc3ccccc3c3[nH]c4ccccc4c23)c1O |
| InChI | InChI=1S/C29H27N5O5/c1-17-11-18(28(38)19(12-17)14-34(15-24(35)36)16-25(37)39-2)13-30-33-29-26-20-7-3-5-9-22(20)31-27(26)21-8-4-6-10-23(21)32-29/h3-13,31,38H,14-16H2,1-2H3,(H,32,33)(H,35,36)/b30-13+ |
| InChIKey | SJLQILRYSUYSNU-VVEOGCPPSA-N |
| XLogP | 4.39 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|