C19H12BF2N3O — CID 139140158
2,2-bis(2-fluoro-3-pyridinyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 139140158) has the molecular formula C19H12BF2N3O and a molecular weight of 347.13 g/mol. Its IUPAC name is 2,2-bis(2-fluoro-3-pyridinyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 2,2-bis(2-fluoro-3-pyridinyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 139140158 |
| Molecular Formula | C19H12BF2N3O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2,2-bis(2-fluoro-3-pyridinyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | Fc1ncccc1[B-]1(c2cccnc2F)Oc2cccc3ccc[n+]1c23 |
| InChI | InChI=1S/C19H12BF2N3O/c21-18-14(7-2-10-23-18)20(15-8-3-11-24-19(15)22)25-12-4-6-13-5-1-9-16(26-20)17(13)25/h1-12H |
| InChIKey | HAUVEKYPVYGEBL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|