About nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate)
nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) (PubChem CID 139141092) has the molecular formula C24H18N8NiO2
and a molecular weight of 509.16 g/mol. Its IUPAC name is nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate).
Molecular Properties
| Compound Name | nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) |
| PubChem CID | 139141092 |
| Molecular Formula | C24H18N8NiO2 |
| Molecular Weight | 509.16 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) |
| SMILES | [Ni+2].[O-]/C(=N\N=C/c1ccccn1)c1ccncc1.[O-]/C(=N\N=C\c1ccccn1)c1ccncc1 |
| InChI | InChI=1S/2C12H10N4O.Ni/c2*17-12(10-4-7-13-8-5-10)16-15-9-11-3-1-2-6-14-11;/h2*1-9H,(H,16,17);/q;;+2/p-2/b15-9+;15-9-; |
| InChIKey | SORJAVLVNDZZJS-UQUFOXQCSA-L |
| XLogP | 1.23 |
| TPSA | 147.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate)?
The IUPAC name of nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) (CID 139141092) is nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate).
What is the SMILES notation for nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate)?
The canonical SMILES for nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) is [Ni+2].[O-]/C(=N\N=C/c1ccccn1)c1ccncc1.[O-]/C(=N\N=C\c1ccccn1)c1ccncc1.
What is the InChIKey of nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate)?
The InChIKey is SORJAVLVNDZZJS-UQUFOXQCSA-L. The full InChI is InChI=1S/2C12H10N4O.Ni/c2*17-12(10-4-7-13-8-5-10)16-15-9-11-3-1-2-6-14-11;/h2*1-9H,(H,16,17);/q;;+2/p-2/b15-9+;15-9-;.
What are the key properties of nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate)?
nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) has a molecular weight of 509.16 g/mol, XLogP of 1.23, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);bis((NE,4Z)-N-(pyridin-2-ylmethylidene)pyridine-4-carbohydrazonate) is sourced from PubChem (CID 139141092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).