About 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+)
2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) (PubChem CID 139141169) has the molecular formula C20H21N2O6Ru
and a molecular weight of 486.47 g/mol. Its IUPAC name is 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+).
Molecular Properties
| Compound Name | 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) |
| PubChem CID | 139141169 |
| Molecular Formula | C20H21N2O6Ru |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) |
| SMILES | CC(=O)/C=C(/C)[O-].CC(=O)/C=C(/C)[O-].[O-]c1cccnc1-c1ncccc1O.[Ru+3] |
| InChI | InChI=1S/C10H8N2O2.2C5H8O2.Ru/c13-7-3-1-5-11-9(7)10-8(14)4-2-6-12-10;2*1-4(6)3-5(2)7;/h1-6,13-14H;2*3,6H,1-2H3;/q;;;+3/p-3/b;2*4-3-; |
| InChIKey | ACJRLLCJPXIFGR-QDMRRLORSA-K |
| XLogP | 0.60 |
| TPSA | 149.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+)?
The IUPAC name of 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) (CID 139141169) is 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+).
What is the SMILES notation for 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+)?
The canonical SMILES for 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) is CC(=O)/C=C(/C)[O-].CC(=O)/C=C(/C)[O-].[O-]c1cccnc1-c1ncccc1O.[Ru+3].
What is the InChIKey of 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+)?
The InChIKey is ACJRLLCJPXIFGR-QDMRRLORSA-K. The full InChI is InChI=1S/C10H8N2O2.2C5H8O2.Ru/c13-7-3-1-5-11-9(7)10-8(14)4-2-6-12-10;2*1-4(6)3-5(2)7;/h1-6,13-14H;2*3,6H,1-2H3;/q;;;+3/p-3/b;2*4-3-;.
What are the key properties of 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+)?
2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) has a molecular weight of 486.47 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxy-2-pyridinyl)pyridin-3-olate;bis((Z)-4-oxopent-2-en-2-olate);ruthenium(3+) is sourced from PubChem (CID 139141169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).