C9H8N4O4S — CID 139142208
2-[(2Z)-2-(2-amino-1-cyano-2-oxoethylidene)hydrazinyl]benzenesulfonic acid (PubChem CID 139142208) has the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-amino-1-cyano-2-oxoethylidene)hydrazinyl]benzenesulfonic acid.
| Compound Name | 2-[(2Z)-2-(2-amino-1-cyano-2-oxoethylidene)hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 139142208 |
| Molecular Formula | C9H8N4O4S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-[(2Z)-2-(2-amino-1-cyano-2-oxoethylidene)hydrazinyl]benzenesulfonic acid |
| SMILES | N#C/C(=N/Nc1ccccc1S(=O)(=O)O)C(N)=O |
| InChI | InChI=1S/C9H8N4O4S/c10-5-7(9(11)14)13-12-6-3-1-2-4-8(6)18(15,16)17/h1-4,12H,(H2,11,14)(H,15,16,17)/b13-7- |
| InChIKey | NGAAAQRBHWKQIQ-QPEQYQDCSA-N |
| XLogP | -0.29 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|