C56H76CrN2O6 — CID 139142290
chromium(6+);bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate) (PubChem CID 139142290) has the molecular formula C56H76CrN2O6 and a molecular weight of 925.23 g/mol. Its IUPAC name is chromium(6+);bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate).
| Compound Name | chromium(6+);bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate) |
|---|---|
| PubChem CID | 139142290 |
| Molecular Formula | C56H76CrN2O6 |
| Molecular Weight | 925.23 g/mol |
| Exact Mass | 924.51 |
| IUPAC Name | chromium(6+);bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate) |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1[O-])[N-]c1c([O-])c(C(C)(C)C)cc(C(C)(C)C)c1O2.CC(C)(C)c1cc(C(C)(C)C)c2c(c1[O-])[N-]c1c([O-])c(C(C)(C)C)cc(C(C)(C)C)c1O2.[Cr+6] |
| InChI | InChI=1S/2C28H40NO3.Cr/c2*1-25(2,3)15-13-17(27(7,8)9)23-19(21(15)30)29-20-22(31)16(26(4,5)6)14-18(24(20)32-23)28(10,11)12;/h2*13-14,30-31H,1-12H3;/q2*-1;+6/p-4 |
| InChIKey | PHTMMXQHZCYAKF-UHFFFAOYSA-J |
| XLogP | 14.93 |
| TPSA | 138.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.23 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |