C38H34N6 — CID 139142362
(4E)-4-(3,3-dimethylindol-2-yl)-15-(3,3-dimethyl-1H-indol-2-ylidene)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,16,18,20-decaene (PubChem CID 139142362) has the molecular formula C38H34N6 and a molecular weight of 574.73 g/mol. Its IUPAC name is (4E)-4-(3,3-dimethylindol-2-yl)-15-(3,3-dimethyl-1H-indol-2-ylidene)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,16,18,20-decaene.
| Compound Name | (4E)-4-(3,3-dimethylindol-2-yl)-15-(3,3-dimethyl-1H-indol-2-ylidene)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,16,18,20-decaene |
|---|---|
| PubChem CID | 139142362 |
| Molecular Formula | C38H34N6 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (4E)-4-(3,3-dimethylindol-2-yl)-15-(3,3-dimethyl-1H-indol-2-ylidene)-2,6,13,17-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,4,7,9,11,13,16,18,20-decaene |
| SMILES | CC1(C)C(C2=C/Nc3ccccc3/N=C/C(=C3Nc4ccccc4C3(C)C)/C=N/c3ccccc3\N=C\2)=Nc2ccccc21 |
| InChI | InChI=1S/C38H34N6/c1-37(2)27-13-5-7-15-29(27)43-35(37)25-21-39-31-17-9-11-19-33(31)41-23-26(24-42-34-20-12-10-18-32(34)40-22-25)36-38(3,4)28-14-6-8-16-30(28)44-36/h5-24,39,44H,1-4H3/b25-21+,36-26?,40-22+,41-23+,42-24+ |
| InChIKey | GZYHLZOBXORUMS-HZICESOISA-N |
| XLogP | 9.52 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |