About CID 139143452
CID 139143452 (PubChem CID 139143452) has the molecular formula C50H35N3O+4
and a molecular weight of 693.85 g/mol.
Molecular Properties
| Compound Name | CID 139143452 |
| PubChem CID | 139143452 |
| Molecular Formula | C50H35N3O+4 |
| Molecular Weight | 693.85 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | — |
| SMILES | OC1=C2c3cccc[cH+]c3/C1=C(\c1ccccc1)c1ccc([nH]1)[C+](c1ccccc1)c1ccc([nH]1)[C+](c1ccccc1)c1ccc([nH]1)[C+]2c1ccccc1 |
| InChI | InChI=1S/C50H34N3O/c54-50-48-36-24-14-5-15-25-37(36)49(50)47(35-22-12-4-13-23-35)43-31-29-41(53-43)45(33-18-8-2-9-19-33)39-27-26-38(51-39)44(32-16-6-1-7-17-32)40-28-30-42(52-40)46(48)34-20-10-3-11-21-34/h1-31,51-53H/q+3/p+1/b48-46- |
| InChIKey | QIKDBIHFANNXEW-XNJRDNTDSA-O |
| XLogP | 11.22 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 693.85 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 139143452 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139143452?
The IUPAC name of CID 139143452 (CID 139143452) is not available.
What is the SMILES notation for CID 139143452?
The canonical SMILES for CID 139143452 is OC1=C2c3cccc[cH+]c3/C1=C(\c1ccccc1)c1ccc([nH]1)[C+](c1ccccc1)c1ccc([nH]1)[C+](c1ccccc1)c1ccc([nH]1)[C+]2c1ccccc1.
What is the InChIKey of CID 139143452?
The InChIKey is QIKDBIHFANNXEW-XNJRDNTDSA-O. The full InChI is InChI=1S/C50H34N3O/c54-50-48-36-24-14-5-15-25-37(36)49(50)47(35-22-12-4-13-23-35)43-31-29-41(53-43)45(33-18-8-2-9-19-33)39-27-26-38(51-39)44(32-16-6-1-7-17-32)40-28-30-42(52-40)46(48)34-20-10-3-11-21-34/h1-31,51-53H/q+3/p+1/b48-46-.
What are the key properties of CID 139143452?
CID 139143452 has a molecular weight of 693.85 g/mol, XLogP of 11.22, 4 rotatable bonds, 4 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139143452 is sourced from PubChem (CID 139143452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).