C68H104N4O4U — CID 139144062
2,4-ditert-butyl-6-[[4,7,10-tris[(3,5-ditert-butyl-2-oxidophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phenolate;uranium(4+) (PubChem CID 139144062) has the molecular formula C68H104N4O4U and a molecular weight of 1279.63 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[4,7,10-tris[(3,5-ditert-butyl-2-oxidophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phenolate;uranium(4+).
| Compound Name | 2,4-ditert-butyl-6-[[4,7,10-tris[(3,5-ditert-butyl-2-oxidophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phenolate;uranium(4+) |
|---|---|
| PubChem CID | 139144062 |
| Molecular Formula | C68H104N4O4U |
| Molecular Weight | 1279.63 g/mol |
| Exact Mass | 1278.86 |
| IUPAC Name | 2,4-ditert-butyl-6-[[4,7,10-tris[(3,5-ditert-butyl-2-oxidophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]phenolate;uranium(4+) |
| SMILES | CC(C)(C)c1cc(CN2CCN(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3[O-])CCN(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3[O-])CCN(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3[O-])CC2)c([O-])c(C(C)(C)C)c1.[U+4] |
| InChI | InChI=1S/C68H108N4O4.U/c1-61(2,3)49-33-45(57(73)53(37-49)65(13,14)15)41-69-25-27-70(42-46-34-50(62(4,5)6)38-54(58(46)74)66(16,17)18)29-31-72(44-48-36-52(64(10,11)12)40-56(60(48)76)68(22,23)24)32-30-71(28-26-69)43-47-35-51(63(7,8)9)39-55(59(47)75)67(19,20)21;/h33-40,73-76H,25-32,41-44H2,1-24H3;/q;+4/p-4 |
| InChIKey | JXXIYEQYBPWFMG-UHFFFAOYSA-J |
| XLogP | 12.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1279.63 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |