C16H16N12 — CID 139144272
6-pyridin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 139144272) has the molecular formula C16H16N12 and a molecular weight of 376.39 g/mol. Its IUPAC name is 6-pyridin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-pyridin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139144272 |
| Molecular Formula | C16H16N12 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 6-pyridin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2ccncc2)n1.Nc1nc(N)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/2C8H8N6/c2*9-7-12-6(13-8(10)14-7)5-1-3-11-4-2-5/h2*1-4H,(H4,9,10,12,13,14) |
| InChIKey | CHGRVLLPQYTNGJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 207.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |