About 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol
2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol (PubChem CID 139144575) has the molecular formula C35H28O5
and a molecular weight of 528.60 g/mol. Its IUPAC name is 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol.
Molecular Properties
| Compound Name | 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol |
| PubChem CID | 139144575 |
| Molecular Formula | C35H28O5 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol |
| SMILES | CCO.O=C1c2ccccc2C(=O)C1(c1ccc(O)c(-c2ccccc2)c1)c1ccc(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C33H22O4.C2H6O/c34-29-17-15-23(19-27(29)21-9-3-1-4-10-21)33(31(36)25-13-7-8-14-26(25)32(33)37)24-16-18-30(35)28(20-24)22-11-5-2-6-12-22;1-2-3/h1-20,34-35H;3H,2H2,1H3 |
| InChIKey | SKZIKWLCEAXXSP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol?
The IUPAC name of 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol (CID 139144575) is 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol.
What is the SMILES notation for 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol?
The canonical SMILES for 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol is CCO.O=C1c2ccccc2C(=O)C1(c1ccc(O)c(-c2ccccc2)c1)c1ccc(O)c(-c2ccccc2)c1.
What is the InChIKey of 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol?
The InChIKey is SKZIKWLCEAXXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H22O4.C2H6O/c34-29-17-15-23(19-27(29)21-9-3-1-4-10-21)33(31(36)25-13-7-8-14-26(25)32(33)37)24-16-18-30(35)28(20-24)22-11-5-2-6-12-22;1-2-3/h1-20,34-35H;3H,2H2,1H3.
What are the key properties of 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol?
2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol has a molecular weight of 528.60 g/mol, XLogP of 6.80, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(4-hydroxy-3-phenylphenyl)indene-1,3-dione;ethanol is sourced from PubChem (CID 139144575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).