About adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline)
adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) (PubChem CID 139144650) has the molecular formula C36H32N4O4
and a molecular weight of 584.68 g/mol. Its IUPAC name is adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline).
Molecular Properties
| Compound Name | adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) |
| PubChem CID | 139144650 |
| Molecular Formula | C36H32N4O4 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) |
| SMILES | O=C(O)C12CC3CC(C1)CC(C(=O)O)(C3)C2.c1cnc2c(c1)ccc1ncccc12.c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/2C12H8N2.C12H16O4/c2*1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;13-9(14)11-2-7-1-8(4-11)5-12(3-7,6-11)10(15)16/h2*1-8H;7-8H,1-6H2,(H,13,14)(H,15,16) |
| InChIKey | HIKJQBJPHRFZOJ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline)?
The IUPAC name of adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) (CID 139144650) is adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline).
What is the SMILES notation for adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline)?
The canonical SMILES for adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) is O=C(O)C12CC3CC(C1)CC(C(=O)O)(C3)C2.c1cnc2c(c1)ccc1ncccc12.c1cnc2c(c1)ccc1ncccc12.
What is the InChIKey of adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline)?
The InChIKey is HIKJQBJPHRFZOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8N2.C12H16O4/c2*1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;13-9(14)11-2-7-1-8(4-11)5-12(3-7,6-11)10(15)16/h2*1-8H;7-8H,1-6H2,(H,13,14)(H,15,16).
What are the key properties of adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline)?
adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) has a molecular weight of 584.68 g/mol, XLogP of 7.31, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1,3-dicarboxylic acid;bis(1,7-phenanthroline) is sourced from PubChem (CID 139144650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).