C39H40Br3NO3 — CID 139145052
4-methylpyridine;1,3,5-tris[(4-bromophenoxy)methyl]-2,4,6-triethylbenzene (PubChem CID 139145052) has the molecular formula C39H40Br3NO3 and a molecular weight of 810.47 g/mol. Its IUPAC name is 4-methylpyridine;1,3,5-tris[(4-bromophenoxy)methyl]-2,4,6-triethylbenzene.
| Compound Name | 4-methylpyridine;1,3,5-tris[(4-bromophenoxy)methyl]-2,4,6-triethylbenzene |
|---|---|
| PubChem CID | 139145052 |
| Molecular Formula | C39H40Br3NO3 |
| Molecular Weight | 810.47 g/mol |
| Exact Mass | 807.06 |
| IUPAC Name | 4-methylpyridine;1,3,5-tris[(4-bromophenoxy)methyl]-2,4,6-triethylbenzene |
| SMILES | CCc1c(COc2ccc(Br)cc2)c(CC)c(COc2ccc(Br)cc2)c(CC)c1COc1ccc(Br)cc1.Cc1ccncc1 |
| InChI | InChI=1S/C33H33Br3O3.C6H7N/c1-4-28-31(19-37-25-13-7-22(34)8-14-25)29(5-2)33(21-39-27-17-11-24(36)12-18-27)30(6-3)32(28)20-38-26-15-9-23(35)10-16-26;1-6-2-4-7-5-3-6/h7-18H,4-6,19-21H2,1-3H3;2-5H,1H3 |
| InChIKey | PKEXUALHJABJKZ-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.47 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |