C14H16N6O2 — CID 139145186
6-phenyl-1,3,5-triazine-2,4-diamine;piperidine-2,6-dione (PubChem CID 139145186) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 6-phenyl-1,3,5-triazine-2,4-diamine;piperidine-2,6-dione.
| Compound Name | 6-phenyl-1,3,5-triazine-2,4-diamine;piperidine-2,6-dione |
|---|---|
| PubChem CID | 139145186 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 6-phenyl-1,3,5-triazine-2,4-diamine;piperidine-2,6-dione |
| SMILES | Nc1nc(N)nc(-c2ccccc2)n1.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C9H9N5.C5H7NO2/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;7-4-2-1-3-5(8)6-4/h1-5H,(H4,10,11,12,13,14);1-3H2,(H,6,7,8) |
| InChIKey | TUAVWOVZHSEZTK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|