About azanium;1,2,3-tri(propan-2-yl)guanidine;iodide
azanium;1,2,3-tri(propan-2-yl)guanidine;iodide (PubChem CID 139145548) has the molecular formula C10H27IN4
and a molecular weight of 330.26 g/mol. Its IUPAC name is azanium;1,2,3-tri(propan-2-yl)guanidine;iodide.
Molecular Properties
| Compound Name | azanium;1,2,3-tri(propan-2-yl)guanidine;iodide |
| PubChem CID | 139145548 |
| Molecular Formula | C10H27IN4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | azanium;1,2,3-tri(propan-2-yl)guanidine;iodide |
| SMILES | CC(C)N=C(NC(C)C)NC(C)C.[I-].[NH4+] |
| InChI | InChI=1S/C10H23N3.HI.H3N/c1-7(2)11-10(12-8(3)4)13-9(5)6;;/h7-9H,1-6H3,(H2,11,12,13);1H;1H3 |
| InChIKey | VCUUVPWFDKFTTK-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azanium;1,2,3-tri(propan-2-yl)guanidine;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;1,2,3-tri(propan-2-yl)guanidine;iodide?
The IUPAC name of azanium;1,2,3-tri(propan-2-yl)guanidine;iodide (CID 139145548) is azanium;1,2,3-tri(propan-2-yl)guanidine;iodide.
What is the SMILES notation for azanium;1,2,3-tri(propan-2-yl)guanidine;iodide?
The canonical SMILES for azanium;1,2,3-tri(propan-2-yl)guanidine;iodide is CC(C)N=C(NC(C)C)NC(C)C.[I-].[NH4+].
What is the InChIKey of azanium;1,2,3-tri(propan-2-yl)guanidine;iodide?
The InChIKey is VCUUVPWFDKFTTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3.HI.H3N/c1-7(2)11-10(12-8(3)4)13-9(5)6;;/h7-9H,1-6H3,(H2,11,12,13);1H;1H3.
What are the key properties of azanium;1,2,3-tri(propan-2-yl)guanidine;iodide?
azanium;1,2,3-tri(propan-2-yl)guanidine;iodide has a molecular weight of 330.26 g/mol, XLogP of -0.87, 3 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;1,2,3-tri(propan-2-yl)guanidine;iodide is sourced from PubChem (CID 139145548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).