C40H38Br2N6O2 — CID 139145637
bis((NE)-N-[1-(4-bromophenyl)ethylidene]hydroxylamine);2-methyl-1-[[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]methyl]benzimidazole (PubChem CID 139145637) has the molecular formula C40H38Br2N6O2 and a molecular weight of 794.59 g/mol. Its IUPAC name is bis((NE)-N-[1-(4-bromophenyl)ethylidene]hydroxylamine);2-methyl-1-[[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]methyl]benzimidazole.
| Compound Name | bis((NE)-N-[1-(4-bromophenyl)ethylidene]hydroxylamine);2-methyl-1-[[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]methyl]benzimidazole |
|---|---|
| PubChem CID | 139145637 |
| Molecular Formula | C40H38Br2N6O2 |
| Molecular Weight | 794.59 g/mol |
| Exact Mass | 792.14 |
| IUPAC Name | bis((NE)-N-[1-(4-bromophenyl)ethylidene]hydroxylamine);2-methyl-1-[[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]methyl]benzimidazole |
| SMILES | C/C(=N\O)c1ccc(Br)cc1.C/C(=N\O)c1ccc(Br)cc1.Cc1nc2ccccc2n1Cc1ccc(Cn2c(C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H22N4.2C8H8BrNO/c1-17-25-21-7-3-5-9-23(21)27(17)15-19-11-13-20(14-12-19)16-28-18(2)26-22-8-4-6-10-24(22)28;2*1-6(10-11)7-2-4-8(9)5-3-7/h3-14H,15-16H2,1-2H3;2*2-5,11H,1H3/b;2*10-6+ |
| InChIKey | PBOONXDBSPCUAZ-WDOPILHBSA-N |
| XLogP | 10.39 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.59 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|