About bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine
bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine (PubChem CID 139145688) has the molecular formula C24H22N4O4
and a molecular weight of 430.46 g/mol. Its IUPAC name is bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine |
| PubChem CID | 139145688 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine |
| SMILES | Nc1ccc(C(=O)O)cc1.Nc1ccc(C(=O)O)cc1.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2C7H7NO2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*8-6-3-1-5(2-4-6)7(9)10/h1-8H;2*1-4H,8H2,(H,9,10) |
| InChIKey | HCEROOIZSBEYIX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine?
The IUPAC name of bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine (CID 139145688) is bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine.
What is the SMILES notation for bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine?
The canonical SMILES for bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine is Nc1ccc(C(=O)O)cc1.Nc1ccc(C(=O)O)cc1.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine?
The InChIKey is HCEROOIZSBEYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C7H7NO2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*8-6-3-1-5(2-4-6)7(9)10/h1-8H;2*1-4H,8H2,(H,9,10).
What are the key properties of bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine?
bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine has a molecular weight of 430.46 g/mol, XLogP of 4.08, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-aminobenzoic acid);2-pyridin-2-ylpyridine is sourced from PubChem (CID 139145688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).