About bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine
bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine (PubChem CID 139145690) has the molecular formula C24H18N4O8
and a molecular weight of 490.43 g/mol. Its IUPAC name is bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine |
| PubChem CID | 139145690 |
| Molecular Formula | C24H18N4O8 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1.O=C(O)c1ccc([N+](=O)[O-])cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2C7H5NO4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*9-7(10)5-1-3-6(4-2-5)8(11)12/h1-8H;2*1-4H,(H,9,10) |
| InChIKey | DVMHFEZUTATOHN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 186.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine?
The IUPAC name of bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine (CID 139145690) is bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine.
What is the SMILES notation for bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine?
The canonical SMILES for bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine is O=C(O)c1ccc([N+](=O)[O-])cc1.O=C(O)c1ccc([N+](=O)[O-])cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine?
The InChIKey is DVMHFEZUTATOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C7H5NO4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*9-7(10)5-1-3-6(4-2-5)8(11)12/h1-8H;2*1-4H,(H,9,10).
What are the key properties of bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine?
bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine has a molecular weight of 490.43 g/mol, XLogP of 4.73, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrobenzoic acid);4-pyridin-4-ylpyridine is sourced from PubChem (CID 139145690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).