About 1H-pyridine-4-thione
1H-pyridine-4-thione (PubChem CID 139145806) has the molecular formula C10H10N2S2
and a molecular weight of 222.34 g/mol. Its IUPAC name is 1H-pyridine-4-thione.
Molecular Properties
| Compound Name | 1H-pyridine-4-thione |
| PubChem CID | 139145806 |
| Molecular Formula | C10H10N2S2 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 1H-pyridine-4-thione |
| SMILES | S=c1cc[nH]cc1.S=c1cc[nH]cc1 |
| InChI | InChI=1S/2C5H5NS/c2*7-5-1-3-6-4-2-5/h2*1-4H,(H,6,7) |
| InChIKey | CQHMPAJBYIXIRR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyridine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyridine-4-thione?
The IUPAC name of 1H-pyridine-4-thione (CID 139145806) is 1H-pyridine-4-thione.
What is the SMILES notation for 1H-pyridine-4-thione?
The canonical SMILES for 1H-pyridine-4-thione is S=c1cc[nH]cc1.S=c1cc[nH]cc1.
What is the InChIKey of 1H-pyridine-4-thione?
The InChIKey is CQHMPAJBYIXIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5NS/c2*7-5-1-3-6-4-2-5/h2*1-4H,(H,6,7).
What are the key properties of 1H-pyridine-4-thione?
1H-pyridine-4-thione has a molecular weight of 222.34 g/mol, XLogP of 3.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyridine-4-thione is sourced from PubChem (CID 139145806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).