C30H26N6+2 — CID 139145989
1-[[3,5-bis(3H-benzimidazol-1-ium-1-ylmethyl)phenyl]methyl]benzimidazole (PubChem CID 139145989) has the molecular formula C30H26N6+2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[[3,5-bis(3H-benzimidazol-1-ium-1-ylmethyl)phenyl]methyl]benzimidazole.
| Compound Name | 1-[[3,5-bis(3H-benzimidazol-1-ium-1-ylmethyl)phenyl]methyl]benzimidazole |
|---|---|
| PubChem CID | 139145989 |
| Molecular Formula | C30H26N6+2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[[3,5-bis(3H-benzimidazol-1-ium-1-ylmethyl)phenyl]methyl]benzimidazole |
| SMILES | c1ccc2c(c1)ncn2Cc1cc(C[n+]2c[nH]c3ccccc32)cc(C[n+]2c[nH]c3ccccc32)c1 |
| InChI | InChI=1S/C30H24N6/c1-4-10-28-25(7-1)31-19-34(28)16-22-13-23(17-35-20-32-26-8-2-5-11-29(26)35)15-24(14-22)18-36-21-33-27-9-3-6-12-30(27)36/h1-15,19-21H,16-18H2/p+2 |
| InChIKey | RNKWZMACFYRTLT-UHFFFAOYSA-P |
| XLogP | 4.72 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|