About tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate
tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate (PubChem CID 139146257) has the molecular formula C33H40N2O3
and a molecular weight of 512.69 g/mol. Its IUPAC name is tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate.
Molecular Properties
| Compound Name | tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate |
| PubChem CID | 139146257 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate |
| SMILES | CC(C)(C)[NH3+].CO.O=C([O-])[C@H](Cc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25NO2.C4H11N.CH4O/c30-27(31)26(21-22-13-5-1-6-14-22)29-28(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-4(2,3)5;1-2/h1-20,26,29H,21H2,(H,30,31);5H2,1-3H3;2H,1H3/t26-;;/m0../s1 |
| InChIKey | OBMWQIFURPVGIE-ROPHLPQBSA-N |
| XLogP | 3.56 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate?
The IUPAC name of tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate (CID 139146257) is tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate.
What is the SMILES notation for tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate?
The canonical SMILES for tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate is CC(C)(C)[NH3+].CO.O=C([O-])[C@H](Cc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate?
The InChIKey is OBMWQIFURPVGIE-ROPHLPQBSA-N. The full InChI is InChI=1S/C28H25NO2.C4H11N.CH4O/c30-27(31)26(21-22-13-5-1-6-14-22)29-28(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-4(2,3)5;1-2/h1-20,26,29H,21H2,(H,30,31);5H2,1-3H3;2H,1H3/t26-;;/m0../s1.
What are the key properties of tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate?
tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate has a molecular weight of 512.69 g/mol, XLogP of 3.56, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylazanium;methanol;(2S)-3-phenyl-2-(tritylamino)propanoate is sourced from PubChem (CID 139146257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).