About 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium
2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium (PubChem CID 139146325) has the molecular formula C17H12Cl4N2O4
and a molecular weight of 450.11 g/mol. Its IUPAC name is 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium.
Molecular Properties
| Compound Name | 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium |
| PubChem CID | 139146325 |
| Molecular Formula | C17H12Cl4N2O4 |
| Molecular Weight | 450.11 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium |
| SMILES | O=C(O)c1c(Cl)cccc1Cl.O=C([O-])c1c(Cl)cccc1Cl.c1c[nH][nH+]c1 |
| InChI | InChI=1S/2C7H4Cl2O2.C3H4N2/c2*8-4-2-1-3-5(9)6(4)7(10)11;1-2-4-5-3-1/h2*1-3H,(H,10,11);1-3H,(H,4,5) |
| InChIKey | YFONAKQAMCXPRX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium?
The IUPAC name of 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium (CID 139146325) is 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium.
What is the SMILES notation for 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium?
The canonical SMILES for 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium is O=C(O)c1c(Cl)cccc1Cl.O=C([O-])c1c(Cl)cccc1Cl.c1c[nH][nH+]c1.
What is the InChIKey of 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium?
The InChIKey is YFONAKQAMCXPRX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H4Cl2O2.C3H4N2/c2*8-4-2-1-3-5(9)6(4)7(10)11;1-2-4-5-3-1/h2*1-3H,(H,10,11);1-3H,(H,4,5).
What are the key properties of 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium?
2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium has a molecular weight of 450.11 g/mol, XLogP of 3.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorobenzoate;2,6-dichlorobenzoic acid;1H-pyrazol-2-ium is sourced from PubChem (CID 139146325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).