About 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine
4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine (PubChem CID 139146373) has the molecular formula C32H32N2O2
and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine |
| PubChem CID | 139146373 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine |
| SMILES | Oc1ccc(C23CC4CC(C2)CC(c2ccc(O)cc2)(C4)C3)cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C22H24O2.C10H8N2/c23-19-5-1-17(2-6-19)21-10-15-9-16(11-21)13-22(12-15,14-21)18-3-7-20(24)8-4-18;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-8,15-16,23-24H,9-14H2;1-8H |
| InChIKey | HTBOYDHDGGKCLM-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine?
The IUPAC name of 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine (CID 139146373) is 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine.
What is the SMILES notation for 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine?
The canonical SMILES for 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine is Oc1ccc(C23CC4CC(C2)CC(c2ccc(O)cc2)(C4)C3)cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine?
The InChIKey is HTBOYDHDGGKCLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O2.C10H8N2/c23-19-5-1-17(2-6-19)21-10-15-9-16(11-21)13-22(12-15,14-21)18-3-7-20(24)8-4-18;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-8,15-16,23-24H,9-14H2;1-8H.
What are the key properties of 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine?
4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine has a molecular weight of 476.62 g/mol, XLogP of 7.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4-pyridin-4-ylpyridine is sourced from PubChem (CID 139146373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).