C19H13N9 — CID 139146599
2,6-bis(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine (PubChem CID 139146599) has the molecular formula C19H13N9 and a molecular weight of 367.38 g/mol. Its IUPAC name is 2,6-bis(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine.
| Compound Name | 2,6-bis(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine |
|---|---|
| PubChem CID | 139146599 |
| Molecular Formula | C19H13N9 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2,6-bis(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)pyridine |
| SMILES | c1cc(-c2nc(-c3ccncc3)n[nH]2)nc(-c2nc(-c3ccncc3)n[nH]2)c1 |
| InChI | InChI=1S/C19H13N9/c1-2-14(18-23-16(25-27-18)12-4-8-20-9-5-12)22-15(3-1)19-24-17(26-28-19)13-6-10-21-11-7-13/h1-11H,(H,23,25,27)(H,24,26,28) |
| InChIKey | PZOHHVCEVSBOLS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |