About naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium)
naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) (PubChem CID 139146714) has the molecular formula C58H46O6P2S2
and a molecular weight of 965.08 g/mol. Its IUPAC name is naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium).
Molecular Properties
| Compound Name | naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) |
| PubChem CID | 139146714 |
| Molecular Formula | C58H46O6P2S2 |
| Molecular Weight | 965.08 g/mol |
| Exact Mass | 964.22 |
| IUPAC Name | naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) |
| SMILES | O=S(=O)([O-])c1ccc2cc(S(=O)(=O)[O-])ccc2c1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C24H20P.C10H8O6S2/c2*1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9/h2*1-20H;1-6H,(H,11,12,13)(H,14,15,16)/q2*+1;/p-2 |
| InChIKey | BUYOOPPIGQOHID-UHFFFAOYSA-L |
| XLogP | 9.26 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 965.08 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium)?
The IUPAC name of naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) (CID 139146714) is naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium).
What is the SMILES notation for naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium)?
The canonical SMILES for naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) is O=S(=O)([O-])c1ccc2cc(S(=O)(=O)[O-])ccc2c1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium)?
The InChIKey is BUYOOPPIGQOHID-UHFFFAOYSA-L. The full InChI is InChI=1S/2C24H20P.C10H8O6S2/c2*1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9/h2*1-20H;1-6H,(H,11,12,13)(H,14,15,16)/q2*+1;/p-2.
What are the key properties of naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium)?
naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) has a molecular weight of 965.08 g/mol, XLogP of 9.26, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2,6-disulfonate;bis(tetraphenylphosphanium) is sourced from PubChem (CID 139146714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).