About bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine
bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139146847) has the molecular formula C40H38N2O6
and a molecular weight of 642.75 g/mol. Its IUPAC name is bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine.
Molecular Properties
| Compound Name | bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| PubChem CID | 139146847 |
| Molecular Formula | C40H38N2O6 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/2C14H14O3.C12H10N2/c2*1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h2*3-9H,1-2H3,(H,15,16);1-10H/b;;2-1+/t2*9-;/m00./s1 |
| InChIKey | IHKAFHITKYLPQE-SZYUIZJOSA-N |
| XLogP | 8.72 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The IUPAC name of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine (CID 139146847) is bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine.
What is the SMILES notation for bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The canonical SMILES for bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine is C(=C/c1ccncc1)\c1ccncc1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.
What is the InChIKey of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The InChIKey is IHKAFHITKYLPQE-SZYUIZJOSA-N. The full InChI is InChI=1S/2C14H14O3.C12H10N2/c2*1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h2*3-9H,1-2H3,(H,15,16);1-10H/b;;2-1+/t2*9-;/m00./s1.
What are the key properties of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine has a molecular weight of 642.75 g/mol, XLogP of 8.72, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine is sourced from PubChem (CID 139146847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).