C45H34N2O7 — CID 139147011
benzene-1,3,5-tricarboxylic acid;(2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one;triphenylene (PubChem CID 139147011) has the molecular formula C45H34N2O7 and a molecular weight of 714.77 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;(2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one;triphenylene.
| Compound Name | benzene-1,3,5-tricarboxylic acid;(2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one;triphenylene |
|---|---|
| PubChem CID | 139147011 |
| Molecular Formula | C45H34N2O7 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.24 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;(2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one;triphenylene |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1.O=C1/C(=C/c2ccncc2)CCC/C1=C\c1ccncc1.c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H16N2O.C18H12.C9H6O6/c21-18-16(12-14-4-8-19-9-5-14)2-1-3-17(18)13-15-6-10-20-11-7-15;1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h4-13H,1-3H2;1-12H;1-3H,(H,10,11)(H,12,13)(H,14,15)/b16-12+,17-13+;; |
| InChIKey | QSIYHYMRHPTHJD-AZMAMVBESA-N |
| XLogP | 9.62 |
| TPSA | 154.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|