C11H4BrN3O2S — CID 139147139
2-(5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)ethene-1,1,2-tricarbonitrile (PubChem CID 139147139) has the molecular formula C11H4BrN3O2S and a molecular weight of 322.14 g/mol. Its IUPAC name is 2-(5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 139147139 |
| Molecular Formula | C11H4BrN3O2S |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 320.92 |
| IUPAC Name | 2-(5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1sc(Br)c2c1OCCO2 |
| InChI | InChI=1S/C11H4BrN3O2S/c12-11-9-8(16-1-2-17-9)10(18-11)7(5-15)6(3-13)4-14/h1-2H2 |
| InChIKey | GQZRDDSUXWSQEA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|