About [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid (PubChem CID 139147142) has the molecular formula C17H17N3O9S
and a molecular weight of 439.40 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid.
Molecular Properties
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid |
| PubChem CID | 139147142 |
| Molecular Formula | C17H17N3O9S |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C12H9N3O5S.C5H8O4/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19;6-4(7)2-1-3-5(8)9/h2-6H,1H3,(H,13,14,17);1-3H2,(H,6,7)(H,8,9) |
| InChIKey | YQVKSZICTGIZMD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 186.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid?
The IUPAC name of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid (CID 139147142) is [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid.
What is the SMILES notation for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid?
The canonical SMILES for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid is CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.O=C(O)CCCC(=O)O.
What is the InChIKey of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid?
The InChIKey is YQVKSZICTGIZMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O5S.C5H8O4/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19;6-4(7)2-1-3-5(8)9/h2-6H,1H3,(H,13,14,17);1-3H2,(H,6,7)(H,8,9).
What are the key properties of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid?
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid has a molecular weight of 439.40 g/mol, XLogP of 2.55, 8 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate;pentanedioic acid is sourced from PubChem (CID 139147142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).