C34H35Cl6NO7P+ — CID 139147147
[6-[[1,3-bis[(2,2-dichloroacetyl)oxy]-2-[(2,2-dichloroacetyl)oxymethyl]propan-2-yl]amino]-6-oxohexyl]-triphenylphosphanium (PubChem CID 139147147) has the molecular formula C34H35Cl6NO7P+ and a molecular weight of 813.35 g/mol. Its IUPAC name is [6-[[1,3-bis[(2,2-dichloroacetyl)oxy]-2-[(2,2-dichloroacetyl)oxymethyl]propan-2-yl]amino]-6-oxohexyl]-triphenylphosphanium.
| Compound Name | [6-[[1,3-bis[(2,2-dichloroacetyl)oxy]-2-[(2,2-dichloroacetyl)oxymethyl]propan-2-yl]amino]-6-oxohexyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 139147147 |
| Molecular Formula | C34H35Cl6NO7P+ |
| Molecular Weight | 813.35 g/mol |
| Exact Mass | 810.03 |
| IUPAC Name | [6-[[1,3-bis[(2,2-dichloroacetyl)oxy]-2-[(2,2-dichloroacetyl)oxymethyl]propan-2-yl]amino]-6-oxohexyl]-triphenylphosphanium |
| SMILES | O=C(CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(COC(=O)C(Cl)Cl)(COC(=O)C(Cl)Cl)COC(=O)C(Cl)Cl |
| InChI | InChI=1S/C34H34Cl6NO7P/c35-28(36)31(43)46-21-34(22-47-32(44)29(37)38,23-48-33(45)30(39)40)41-27(42)19-11-4-12-20-49(24-13-5-1-6-14-24,25-15-7-2-8-16-25)26-17-9-3-10-18-26/h1-3,5-10,13-18,28-30H,4,11-12,19-23H2/p+1 |
| InChIKey | GUQAFTCMFFISDE-UHFFFAOYSA-O |
| XLogP | 6.44 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.35 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|