About 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide
2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide (PubChem CID 139147315) has the molecular formula C34H52Cl2N2O2
and a molecular weight of 591.71 g/mol. Its IUPAC name is 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide |
| PubChem CID | 139147315 |
| Molecular Formula | C34H52Cl2N2O2 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide |
| SMILES | O=C(CCl)NC12C[C@@H]3CC(C[C@@H](C3)C1)C21CCCCC1.O=C(CCl)NC12C[C@@H]3CC(C[C@@H](C3)C1)C21CCCCC1 |
| InChI | InChI=1S/2C17H26ClNO/c2*18-11-15(20)19-17-9-12-6-13(10-17)8-14(7-12)16(17)4-2-1-3-5-16/h2*12-14H,1-11H2,(H,19,20)/t2*12-,13+,14?,17? |
| InChIKey | VKDXSAPKSMWPRY-HOTQFIMDSA-N |
| XLogP | 7.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide?
The IUPAC name of 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide (CID 139147315) is 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide.
What is the SMILES notation for 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide?
The canonical SMILES for 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide is O=C(CCl)NC12C[C@@H]3CC(C[C@@H](C3)C1)C21CCCCC1.O=C(CCl)NC12C[C@@H]3CC(C[C@@H](C3)C1)C21CCCCC1.
What is the InChIKey of 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide?
The InChIKey is VKDXSAPKSMWPRY-HOTQFIMDSA-N. The full InChI is InChI=1S/2C17H26ClNO/c2*18-11-15(20)19-17-9-12-6-13(10-17)8-14(7-12)16(17)4-2-1-3-5-16/h2*12-14H,1-11H2,(H,19,20)/t2*12-,13+,14?,17?.
What are the key properties of 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide?
2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide has a molecular weight of 591.71 g/mol, XLogP of 7.74, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(5R,7S)-spiro[adamantane-2,1'-cyclohexane]-1-yl]acetamide is sourced from PubChem (CID 139147315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).