About bis(5-methylbenzene-1,3-diol);pyrazine
bis(5-methylbenzene-1,3-diol);pyrazine (PubChem CID 139147343) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is bis(5-methylbenzene-1,3-diol);pyrazine.
Molecular Properties
| Compound Name | bis(5-methylbenzene-1,3-diol);pyrazine |
| PubChem CID | 139147343 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | bis(5-methylbenzene-1,3-diol);pyrazine |
| SMILES | Cc1cc(O)cc(O)c1.Cc1cc(O)cc(O)c1.c1cnccn1 |
| InChI | InChI=1S/2C7H8O2.C4H4N2/c2*1-5-2-6(8)4-7(9)3-5;1-2-6-4-3-5-1/h2*2-4,8-9H,1H3;1-4H |
| InChIKey | GVLYUIKUCYRMQY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(5-methylbenzene-1,3-diol);pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-methylbenzene-1,3-diol);pyrazine?
The IUPAC name of bis(5-methylbenzene-1,3-diol);pyrazine (CID 139147343) is bis(5-methylbenzene-1,3-diol);pyrazine.
What is the SMILES notation for bis(5-methylbenzene-1,3-diol);pyrazine?
The canonical SMILES for bis(5-methylbenzene-1,3-diol);pyrazine is Cc1cc(O)cc(O)c1.Cc1cc(O)cc(O)c1.c1cnccn1.
What is the InChIKey of bis(5-methylbenzene-1,3-diol);pyrazine?
The InChIKey is GVLYUIKUCYRMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O2.C4H4N2/c2*1-5-2-6(8)4-7(9)3-5;1-2-6-4-3-5-1/h2*2-4,8-9H,1H3;1-4H.
What are the key properties of bis(5-methylbenzene-1,3-diol);pyrazine?
bis(5-methylbenzene-1,3-diol);pyrazine has a molecular weight of 328.37 g/mol, XLogP of 3.29, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-methylbenzene-1,3-diol);pyrazine is sourced from PubChem (CID 139147343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).