About bis(1H-benzimidazol-3-ium-2-amine);phthalate
bis(1H-benzimidazol-3-ium-2-amine);phthalate (PubChem CID 139147485) has the molecular formula C22H20N6O4
and a molecular weight of 432.44 g/mol. Its IUPAC name is bis(1H-benzimidazol-3-ium-2-amine);phthalate.
Molecular Properties
| Compound Name | bis(1H-benzimidazol-3-ium-2-amine);phthalate |
| PubChem CID | 139147485 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | bis(1H-benzimidazol-3-ium-2-amine);phthalate |
| SMILES | Nc1[nH]c2ccccc2[nH+]1.Nc1[nH]c2ccccc2[nH+]1.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C7H7N3/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10)(H,11,12);2*1-4H,(H3,8,9,10) |
| InChIKey | QXNGYNIJTRBTLX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(1H-benzimidazol-3-ium-2-amine);phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-benzimidazol-3-ium-2-amine);phthalate?
The IUPAC name of bis(1H-benzimidazol-3-ium-2-amine);phthalate (CID 139147485) is bis(1H-benzimidazol-3-ium-2-amine);phthalate.
What is the SMILES notation for bis(1H-benzimidazol-3-ium-2-amine);phthalate?
The canonical SMILES for bis(1H-benzimidazol-3-ium-2-amine);phthalate is Nc1[nH]c2ccccc2[nH+]1.Nc1[nH]c2ccccc2[nH+]1.O=C([O-])c1ccccc1C(=O)[O-].
What is the InChIKey of bis(1H-benzimidazol-3-ium-2-amine);phthalate?
The InChIKey is QXNGYNIJTRBTLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C7H7N3/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10)(H,11,12);2*1-4H,(H3,8,9,10).
What are the key properties of bis(1H-benzimidazol-3-ium-2-amine);phthalate?
bis(1H-benzimidazol-3-ium-2-amine);phthalate has a molecular weight of 432.44 g/mol, XLogP of -0.46, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-benzimidazol-3-ium-2-amine);phthalate is sourced from PubChem (CID 139147485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).