C8H6F6O — CID 139147631
2-cyclopenta-1,3-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 139147631) has the molecular formula C8H6F6O and a molecular weight of 232.12 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 139147631 |
| Molecular Formula | C8H6F6O |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1=CC=CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F6O/c9-7(10,11)6(15,8(12,13)14)5-3-1-2-4-5/h1-3,15H,4H2 |
| InChIKey | LIZXKWJXAYADHH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |