C13H5Cl2F5OS — CID 139147687
1-[[(S)-(2,4-dichlorophenyl)sulfinyl]methyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 139147687) has the molecular formula C13H5Cl2F5OS and a molecular weight of 375.15 g/mol. Its IUPAC name is 1-[[(S)-(2,4-dichlorophenyl)sulfinyl]methyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[[(S)-(2,4-dichlorophenyl)sulfinyl]methyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 139147687 |
| Molecular Formula | C13H5Cl2F5OS |
| Molecular Weight | 375.15 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | 1-[[(S)-(2,4-dichlorophenyl)sulfinyl]methyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | O=[S@@](Cc1c(F)c(F)c(F)c(F)c1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H5Cl2F5OS/c14-5-1-2-8(7(15)3-5)22(21)4-6-9(16)11(18)13(20)12(19)10(6)17/h1-3H,4H2/t22-/m0/s1 |
| InChIKey | NJDUHVKDVAXBKO-QFIPXVFZSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.15 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|