About 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid)
4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) (PubChem CID 139147798) has the molecular formula C36H26F6N6O4
and a molecular weight of 720.63 g/mol. Its IUPAC name is 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid).
Molecular Properties
| Compound Name | 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) |
| PubChem CID | 139147798 |
| Molecular Formula | C36H26F6N6O4 |
| Molecular Weight | 720.63 g/mol |
| Exact Mass | 720.19 |
| IUPAC Name | 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) |
| SMILES | O=C(O)c1cccnc1Nc1cccc(C(F)(F)F)c1.O=C(O)c1cccnc1Nc1cccc(C(F)(F)F)c1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/2C13H9F3N2O2.C10H8N2/c2*14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h2*1-7H,(H,17,18)(H,19,20);1-8H |
| InChIKey | WVGHICCHGZDIKU-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 720.63 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid)?
The IUPAC name of 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) (CID 139147798) is 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid).
What is the SMILES notation for 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid)?
The canonical SMILES for 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) is O=C(O)c1cccnc1Nc1cccc(C(F)(F)F)c1.O=C(O)c1cccnc1Nc1cccc(C(F)(F)F)c1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid)?
The InChIKey is WVGHICCHGZDIKU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H9F3N2O2.C10H8N2/c2*14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h2*1-7H,(H,17,18)(H,19,20);1-8H.
What are the key properties of 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid)?
4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) has a molecular weight of 720.63 g/mol, XLogP of 9.23, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-ylpyridine;bis(2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid) is sourced from PubChem (CID 139147798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).