C25H23NO3 — CID 139148174
methyl (2R,3R,4S,5S)-4-benzoyl-3,5-diphenylpyrrolidine-2-carboxylate (PubChem CID 139148174) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl (2R,3R,4S,5S)-4-benzoyl-3,5-diphenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3R,4S,5S)-4-benzoyl-3,5-diphenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139148174 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | methyl (2R,3R,4S,5S)-4-benzoyl-3,5-diphenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2ccccc2)[C@@H](C(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c1-29-25(28)23-20(17-11-5-2-6-12-17)21(24(27)19-15-9-4-10-16-19)22(26-23)18-13-7-3-8-14-18/h2-16,20-23,26H,1H3/t20-,21-,22+,23+/m0/s1 |
| InChIKey | JPKWLVCFHJRUJN-MYDTUXCISA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |