C38H52B2N2O4 — CID 139148338
1-methyl-6-[(2R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]indole (PubChem CID 139148338) has the molecular formula C38H52B2N2O4 and a molecular weight of 622.47 g/mol. Its IUPAC name is 1-methyl-6-[(2R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]indole.
| Compound Name | 1-methyl-6-[(2R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]indole |
|---|---|
| PubChem CID | 139148338 |
| Molecular Formula | C38H52B2N2O4 |
| Molecular Weight | 622.47 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | 1-methyl-6-[(2R)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-2-yl]indole |
| SMILES | C=C[C@@H](CB1OC(C)(C)C(C)(C)O1)c1ccc2ccn(C)c2c1.C=C[C@@H](CB1OC(C)(C)C(C)(C)O1)c1ccc2ccn(C)c2c1 |
| InChI | InChI=1S/2C19H26BNO2/c2*1-7-14(13-20-22-18(2,3)19(4,5)23-20)16-9-8-15-10-11-21(6)17(15)12-16/h2*7-12,14H,1,13H2,2-6H3/t2*14-/m00/s1 |
| InChIKey | WPSWGKSQPRANKK-DXZWIFNPSA-N |
| XLogP | 9.08 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.47 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|