C14H16F3N3O3 — CID 139148353
methyl N-[(2S,4R)-2-methyl-5-[(2,2,2-trifluoroacetyl)amino]-1,2,3,4-tetrahydroquinolin-4-yl]carbamate (PubChem CID 139148353) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is methyl N-[(2S,4R)-2-methyl-5-[(2,2,2-trifluoroacetyl)amino]-1,2,3,4-tetrahydroquinolin-4-yl]carbamate.
| Compound Name | methyl N-[(2S,4R)-2-methyl-5-[(2,2,2-trifluoroacetyl)amino]-1,2,3,4-tetrahydroquinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 139148353 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl N-[(2S,4R)-2-methyl-5-[(2,2,2-trifluoroacetyl)amino]-1,2,3,4-tetrahydroquinolin-4-yl]carbamate |
| SMILES | COC(=O)N[C@@H]1C[C@H](C)Nc2cccc(NC(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C14H16F3N3O3/c1-7-6-10(20-13(22)23-2)11-8(18-7)4-3-5-9(11)19-12(21)14(15,16)17/h3-5,7,10,18H,6H2,1-2H3,(H,19,21)(H,20,22)/t7-,10+/m0/s1 |
| InChIKey | AOKXOKXRPIZLBJ-OIBJUYFYSA-N |
| XLogP | 2.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |