About [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone
[(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone (PubChem CID 139148630) has the molecular formula C18H17NO3
and a molecular weight of 295.34 g/mol. Its IUPAC name is [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone |
| PubChem CID | 139148630 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone |
| SMILES | CC1(C)C(c2ccccc2)=NO[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-17(2)15(13-9-5-3-6-10-13)19-22-18(17,21)16(20)14-11-7-4-8-12-14/h3-12,21H,1-2H3/t18-/m1/s1 |
| InChIKey | IOHWJYSANZTHQG-GOSISDBHSA-N |
| XLogP | 3.02 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone?
The IUPAC name of [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone (CID 139148630) is [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone.
What is the SMILES notation for [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone?
The canonical SMILES for [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone is CC1(C)C(c2ccccc2)=NO[C@]1(O)C(=O)c1ccccc1.
What is the InChIKey of [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone?
The InChIKey is IOHWJYSANZTHQG-GOSISDBHSA-N. The full InChI is InChI=1S/C18H17NO3/c1-17(2)15(13-9-5-3-6-10-13)19-22-18(17,21)16(20)14-11-7-4-8-12-14/h3-12,21H,1-2H3/t18-/m1/s1.
What are the key properties of [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone?
[(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone has a molecular weight of 295.34 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-5-hydroxy-4,4-dimethyl-3-phenyl-1,2-oxazol-5-yl]-phenylmethanone is sourced from PubChem (CID 139148630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).